PRODUCT Properties
| Melting point: | 140-142 °C(lit.) |
| Boiling point: | 161°C/1.5mmHg(lit.) |
| Density | 1.2599 (rough estimate) |
| refractive index | 1.5380 (estimate) |
| storage temp. | 2-8°C |
| form | Powder |
| color | Slightly yellow to beige |
| Water Solubility | Decomposes in water. |
| Sensitive | Moisture Sensitive |
| BRN | 5244 |
| InChI | InChI=1S/C9H6O3/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-4H,5H2 |
| InChIKey | AKHSBAVQPIRVAG-UHFFFAOYSA-N |
| SMILES | C1(=O)OC(=O)C2=CC=CC=C2C1 |
| CAS DataBase Reference | 703-59-3(CAS DataBase Reference) |
Description and Uses
It is used as a chemical and organic intermediates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29173995 |
