PRODUCT Properties
Melting point: | 140-142 °C(lit.) |
Boiling point: | 161°C/1.5mmHg(lit.) |
Density | 1.2599 (rough estimate) |
refractive index | 1.5380 (estimate) |
storage temp. | 2-8°C |
form | Powder |
color | Slightly yellow to beige |
Water Solubility | Decomposes in water. |
Sensitive | Moisture Sensitive |
BRN | 5244 |
InChI | InChI=1S/C9H6O3/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-4H,5H2 |
InChIKey | AKHSBAVQPIRVAG-UHFFFAOYSA-N |
SMILES | C1(=O)OC(=O)C2=CC=CC=C2C1 |
CAS DataBase Reference | 703-59-3(CAS DataBase Reference) |
Description and Uses
It is used as a chemical and organic intermediates.
Safety
Symbol(GHS) | ![]() GHS07 |
Signal word | Warning |
Hazard statements | H315-H319-H335 |
Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
Hazard Codes | Xi |
Risk Statements | 36/37/38 |
Safety Statements | 26-36 |
WGK Germany | 3 |
F | 10-21 |
HS Code | 29173995 |