BD8447247
4-Chloro-8-methoxy-2-methylquinoline , 98% , 64951-58-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB48.00 | In Stock |
|
| 1g | RMB115.20 | In Stock |
|
| 5g | RMB391.20 | In Stock |
|
| 25g | RMB1723.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80-85 °C |
| Boiling point: | 308.8±37.0 °C(Predicted) |
| Density | 1.228±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| pka | 2.67±0.50(Predicted) |
| Appearance | Light brown to brown Solid |
| InChI | InChI=1S/C11H10ClNO/c1-7-6-9(12)8-4-3-5-10(14-2)11(8)13-7/h3-6H,1-2H3 |
| InChIKey | RHSCPZBPNUZBOA-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2OC)C(Cl)=CC=1C |
| CAS DataBase Reference | 64951-58-2(CAS DataBase Reference) |
Description and Uses
4-CHLORO-8-METHOXY-2-METHYLQUINOLINE is an organic chemical and pharmaceutical intermediate, its chloro group on quinoline core make it uesful for synthesizing functional materials and bioactive molecules.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H318 |
| Precautionary statements | P280-P301+P310-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | 25-41 |
| Safety Statements | 26-39-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933499090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |







