BD8505431
5-Hydroxy-6-nitronicotinic acid , 97% , 59288-43-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB259.20 | In Stock |
|
| 250mg | RMB394.40 | In Stock |
|
| 1g | RMB1162.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 572.4±50.0 °C(Predicted) |
| Density | 1.745±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -1.53±0.10(Predicted) |
| Appearance | Light yellow to yellow Solid |
| InChI | InChI=1S/C6H4N2O5/c9-4-1-3(6(10)11)2-7-5(4)8(12)13/h1-2,9H,(H,10,11) |
| InChIKey | OODZZMDHMOPHHY-UHFFFAOYSA-N |
| SMILES | C1=NC([N+]([O-])=O)=C(O)C=C1C(O)=O |
Description and Uses
5-Hydroxy-6-nitropyridine-3-carboxylic acid is a 5-hydroxynicotinic acid (H948565) derivative used in the preparation of aminoheteroaryl protein kinase inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P |
