BD8565631
5-Bromo-1H-indazole-3-carboxylic acid , 97% , 1077-94-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB42.40 | In Stock |
|
| 5g | RMB209.60 | In Stock |
|
| 10g | RMB404.80 | In Stock |
|
| 25g | RMB794.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 289-292°C |
| Boiling point: | 493.4±25.0 °C(Predicted) |
| Density | 1.946±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 2.81±0.30(Predicted) |
| form | solid |
| color | Off-white |
| InChI | InChI=1S/C8H5BrN2O2/c9-4-1-2-6-5(3-4)7(8(12)13)11-10-6/h1-3H,(H,10,11)(H,12,13) |
| InChIKey | AMJVXOOGGBPVCZ-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Br)C=C2)C(C(O)=O)=N1 |
| CAS DataBase Reference | 1077-94-7(CAS DataBase Reference) |
Description and Uses
5-Bromo-1H-indazole-3-carboxylic acid an important chemical product. It is mainly used as a raw material in chemical synthesis for the preparation of other compounds. Its derivative 5-Bromo-1H-indazole-3-carboxylic acid ethyl ester can be used as a protein kinase inhibitor, which can be used for the treatment and prevention of diseases.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H302+H312+H332 |
| Precautionary statements | P271-P261-P280 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| Safety Statements | 22-26-36/37/39 |
| Hazard Note | Irritant |
| HS Code | 2933998090 |






