BD8591931
(S)-3-Amino-3-(4-chlorophenyl)propanoic acid , 98% , 131690-60-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB199.20 | In Stock |
|
| 250mg | RMB331.20 | In Stock |
|
| 1g | RMB664.80 | In Stock |
|
| 5g | RMB1996.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 345.8±32.0 °C(Predicted) |
| Density | 1.333 |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.62±0.10(Predicted) |
| Appearance | Off-white to gray Solid |
| optical activity | 6.4°(C=1.00g/100ml H2O) |
| InChI | InChI=1/C9H10ClNO2/c10-7-3-1-6(2-4-7)8(11)5-9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/s3 |
| InChIKey | BXGDBHAMTMMNTO-SBYBRXNCNA-N |
| SMILES | [C@H](C1C=CC(Cl)=CC=1)(N)CC(=O)O |&1:0,r| |
| CAS DataBase Reference | 131690-60-3(CAS DataBase Reference) |
Description and Uses
(S)-3-Amino-3-(4-chlorophenyl)-propionic acid is an important chiral amino acid derivative, widely used in drug development and synthesis of bioactive compounds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335-H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |






