BD8636347
AgrimolB , 98+% , 55576-66-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB6860.00 | In Stock |
|
| 250mg | RMB13033.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 922.6±65.0 °C(Predicted) |
| Density | 1.292 |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 7.09±0.50(Predicted) |
| color | White to yellow |
| InChIKey | BVLHMPZMQVWDGX-INIZCTEOSA-N |
| SMILES | C(C1=C(O)C(CC2=C(O)C(C(=O)CCC)=C(OC)C(C)=C2O)=C(O)C(CC2=C(O)C(C(=O)CCC)=C(OC)C(C)=C2O)=C1O)(=O)[C@@H](C)CC |
Description and Uses
Agrimol B, a polyphenol, is an orally active and potent SIRT1 activator. Agrimol B shows anti-adipogenic and anticancer activity. Agrimol B shows antibacterial activity against plant pathogens. Agrimol B dramatically inhibits 3T3-L1 adipocyte differentiation by reducing PPARγ, C/EBPα, FAS, UCP-1, and apoE expression. The action of Agrimol B on the cancer cells is likely derived from its effect on c-MYC, SKP2 and p27[1][2][3].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P321-P362+P364-P332+P313-P337+P313-P403+P233-P405-P501 |
