BD8652031
4-(1H-Imidazol-1-yl)benzoic acid , 98% , 17616-04-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB309.60 | In Stock |
|
| 5g | RMB815.20 | In Stock |
|
| 25g | RMB3600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 305 °C (dec.)(lit.) |
| Boiling point: | 403.6±28.0 °C(Predicted) |
| Density | 1.28±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.65±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C10H8N2O2/c13-10(14)8-1-3-9(4-2-8)12-6-5-11-7-12/h1-7H,(H,13,14) |
| InChIKey | LFIDZIWWYNTQOQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(N2C=NC=C2)C=C1 |
| CAS DataBase Reference | 17616-04-5(CAS DataBase Reference) |
Description and Uses
The series of difunctional organic linkers combining anionic carboxylates and neutral 1H-imidazol-1-yl donors such as 4-(1H-imidazol-1-yl)benzoic acid (HIBA) and 3,5-di(imidazol-1-yl)benzoic acid, which are employed as good candidates for the construction of MOFs[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39-36/37/39-22 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29332900 |






