BD8657231
3-Bromo-2-chloro-6-picoline , 98% , 185017-72-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB79.20 | In Stock |
|
| 10g | RMB140.00 | In Stock |
|
| 25g | RMB333.60 | In Stock |
|
| 100g | RMB1305.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 30-35°C |
| Boiling point: | 234.2±35.0 °C(Predicted) |
| Density | 1.6567 (rough estimate) |
| refractive index | 1.5400 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 0.33±0.10(Predicted) |
| form | Solid |
| color | Yellow |
| InChI | InChI=1S/C6H5BrClN/c1-4-2-3-5(7)6(8)9-4/h2-3H,1H3 |
| InChIKey | JVDQYSIJBRTRMS-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(C)=CC=C1Br |
| CAS DataBase Reference | 185017-72-5(CAS DataBase Reference) |
Description and Uses
3-BROMO-2-CHLORO-6-PICOLINE serves as a versatile intermediate in organic synthesis, particularly in cross-coupling reactions for pharmaceuticals, agrochemicals, and materials science. Its reactivity is influenced by the bromine and chlorine substituents, which act as leaving groups, and the methyl group, which modulates steric and electronic effects.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-41-37/38-25 |
| Safety Statements | 37/39-26-45-39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29333990 |
