BD8672231
7-Bromoisatin , 95% , 20780-74-9
Synonym(s):
7-Bromoindole-1H-2,3-dione
CAS NO.:20780-74-9
Empirical Formula: C8H4BrNO2
Molecular Weight: 226.03
MDL number: MFCD00774354
EINECS: 625-256-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB59.20 | In Stock |
|
| 10g | RMB112.00 | In Stock |
|
| 25g | RMB232.80 | In Stock |
|
| 100g | RMB905.60 | In Stock |
|
| 500g | RMB4471.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 191-198 °C |
| Density | 1.826±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Slightly soluble. |
| pka | 8.69±0.20(Predicted) |
| form | powder to crystal |
| color | Orange to Amber to Dark red |
| InChI | InChI=1S/C8H4BrNO2/c9-5-3-1-2-4-6(5)10-8(12)7(4)11/h1-3H,(H,10,11,12) |
| InChIKey | OCVKSIWBTJCXPV-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2Br)C(=O)C1=O |
| CAS DataBase Reference | 20780-74-9(CAS DataBase Reference) |
Description and Uses
7-bromoisatin was treated with excess PhMgBr to afford tertiary alcohol 9 in 96 % yield. Isatin oxime triflates undergo a facile fragmentation which is promoted by DBU, to form anthranilonitriles after hydrolytic work-up.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |







