BD8833031
2-Chloro-N-(hydroxymethyl)acetamide , 97% , 2832-19-1
CAS NO.：2832-19-1
Empirical Formula: C3H6ClNO2
Molecular Weight: 123.54
MDL number: MFCD00021961
EINECS: 220-598-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 25g | RMB32.00 | In Stock |
|
| 100g | RMB56.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 100-105 °C(lit.) |
| Boiling point: | 374.0±27.0 °C(Predicted) |
| Density | 1.2776 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 12.63±0.46(Predicted) |
| color | White to Off-White |
| Water Solubility | Very soluble in water. Poorly soluble in aliphatic hydrocarbons. |
| Sensitive | Hygroscopic |
| BRN | 1811765 |
| InChI | InChI=1S/C3H6ClNO2/c4-1-3(7)5-2-6/h6H,1-2H2,(H,5,7) |
| InChIKey | TXNSZCSYBXHETP-UHFFFAOYSA-N |
| SMILES | C(NCO)(=O)CCl |
| CAS DataBase Reference | 2832-19-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Chloro-N-(hydroxymethyl)acetamide (2832-19-1) |
Description and Uses
2-Chloro-N-(hydroxymethyl)acetamide (N-hydroxymethylchloroacetamide) may be used as a reagent in the synthesis of 1-(aminomethyl)-2-methoxynaphthalene hydrochloride and as a amidomethylating reagent for N,N-dialkylanilines (Tscherniac-Einhorn reaction).
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C |
| Risk Statements | 34-43-40-20/21/22 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | AB5733000 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | Ⅱ |
| HS Code | 29241990 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
