BD8836131
3-Bromo[1,2,4]triazolo[4,3-a]pyridine , 95% , 4922-68-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB177.60 | In Stock |
|
| 1g | RMB454.40 | In Stock |
|
| 5g | RMB1660.00 | In Stock |
|
| 25g | RMB5168.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-167 °C |
| Density | 1.89±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 0.97±0.50(Predicted) |
| Appearance | Light brown to brown Solid |
| InChI | InChI=1S/C6H4BrN3/c7-6-9-8-5-3-1-2-4-10(5)6/h1-4H |
| InChIKey | BOKHADJFZUWNSH-UHFFFAOYSA-N |
| SMILES | C12=NN=C(Br)N1C=CC=C2 |
Description and Uses
3-Bromo-[1,2,4]triazolo[4,3-a]pyridine is an intermediate used to prepare bi-aryl amines as mGluR5 modulators for treating gastrointestinal, urinary tract, and nervous system disorders.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H310-H302-H315-H319 |
| Precautionary statements | P501-P270-P262-P264-P280-P337+P313-P305+P351+P338-P361+P364-P332+P313-P301+P312+P330-P302+P352+P310-P405 |
| HS Code | 2933998090 |

![3-Bromo[1,2,4]triazolo[4,3-a]pyridine](https://img.chemicalbook.com/CAS/GIF/4922-68-3.gif)



![3-ethynylimidazo[1,2-b]pyridazine](https://img.chemicalbook.com/CAS2/GIF/943320-61-4.gif)

![3-Bromoimidazo[1,2-<i>b</i>]pyridazine](https://img.chemicalbook.com/CAS/GIF/18087-73-5.gif)