BD8866155
(2R,3R,4S,5R)-2-(6-(Dimethylamino)-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol , 97% , 2620-62-4
CAS NO.：2620-62-4
Empirical Formula: C12H17N5O4
Molecular Weight: 295.29
MDL number: MFCD00022822
EINECS: 220-057-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB176.80 | In Stock |
|
| 250mg | RMB294.40 | In Stock |
|
| 1g | RMB823.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 184-185°C |
| Boiling point: | 607.3±65.0 °C(Predicted) |
| Density | 1.71±0.1 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly, Heated), DMSO, Methanol (Sparingly) |
| form | Solid |
| pka | 13.11±0.70(Predicted) |
| color | White to Off-White |
| PH | 4.5 |
| λmax | 268 (pH 1)；275 (pH 7) |
| InChI | InChI=1S/C12H17N5O4/c1-16(2)10-7-11(14-4-13-10)17(5-15-7)12-9(20)8(19)6(3-18)21-12/h4-6,8-9,12,18-20H,3H2,1-2H3/t6-,8-,9-,12-/m1/s1 |
| InChIKey | WVGPGNPCZPYCLK-WOUKDFQISA-N |
| SMILES | OC[C@H]1O[C@@H](N2C3C(=C(N=CN=3)N(C)C)N=C2)[C@H](O)[C@@H]1O |
| CAS DataBase Reference | 2620-62-4(CAS DataBase Reference) |
Description and Uses
6-Dimethylaminopurine-9-riboside (cas# 2620-62-4) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 29349990 |
