BD8873655
(4aS,7S,8aR)-8,8-Dichloro-9,9-dimethyltetrahydro-4H-4a,7-methanobenzo[c][1,2]oxazireno[2,3-b]isothiazole3,3-dioxide , 98% , 127184-05-8
Synonym(s):
(+)-3,3-Dichloro-2,N-epoxy-exo-10,2-bornanesultam
CAS NO.:127184-05-8
Empirical Formula: C10H13Cl2NO3S
Molecular Weight: 298.19
MDL number: MFCD00243015
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB78.40 | In Stock |
|
| 1g | RMB158.40 | In Stock |
|
| 5g | RMB606.40 | In Stock |
|
| 25g | RMB2244.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 181-186 °C |
| Boiling point: | 390.5±52.0 °C(Predicted) |
| Density | 1.68±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -15.63±0.60(Predicted) |
| color | White to Off-White |
| optical activity | [α]20/D +89±3°, c = 0.5% in chloroform |
| BRN | 3653352 |
| InChI | InChI=1/C10H13Cl2NO3S/c1-7(2)6-3-4-8(7)5-17(14,15)13-10(8,16-13)9(6,11)12/h6H,3-5H2,1-2H3/t6-,8-,10+,13?/s3 |
| InChIKey | HAMBQYFZDBYWHU-XCDSEQPNNA-N |
| SMILES | [C@@]123ON1S(=O)(=O)C[C@@]12CC[C@@]([H])(C1(C)C)C3(Cl)Cl |&1:0,7,10,r| |
Description and Uses
Chiral oxidizing agent.
Safety
| Symbol(GHS) | ![]() ![]() GHS03,GHS07 |
| Signal word | Danger |
| Hazard statements | H271-H315-H319-H335 |
| Precautionary statements | P220-P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| RIDADR | 1479 |
| WGK Germany | 3 |
| F | 8-10 |
| HazardClass | 5.1 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |

![(4aS,7S,8aR)-8,8-Dichloro-9,9-dimethyltetrahydro-4H-4a,7-methanobenzo[c][1,2]oxazireno[2,3-b]isothiazole3,3-dioxide](https://img.chemicalbook.com/CAS/GIF/127184-05-8.gif)






