BD8916155
6-heptenoicacid , 98%(stabilizedwithMEHQ) , 1119-60-4
CAS NO.:1119-60-4
Empirical Formula: C7H12O2
Molecular Weight: 128.17
MDL number: MFCD00014382
EINECS: 214-283-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB42.40 | In Stock |
|
| 5g | RMB143.20 | In Stock |
|
| 25g | RMB518.40 | In Stock |
|
| 100g | RMB1711.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -6.5 °C (lit.) |
| Boiling point: | 222-224 °C (lit.) |
| Density | 0.946 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | liquid |
| pka | 4.75±0.10(Predicted) |
| color | Colourless to light yellow |
| Water Solubility | Miscible with water. |
| BRN | 1747265 |
| InChI | InChI=1S/C7H12O2/c1-2-3-4-5-6-7(8)9/h2H,1,3-6H2,(H,8,9) |
| InChIKey | RWNJOXUVHRXHSD-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCC=C |
| LogP | 1.930 (est) |
Description and Uses
6-Heptenoic acid may be used in the preparation of 6-(iodomethyl)-hexanolide, via iodo-lactonization.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2916199590 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





![(3aR,6aS)-3,3a,6,6a-Tetrahydro-2H-cyclopenta[b]furan-2-one](https://img.chemicalbook.com/CAS/GIF/43119-28-4.gif)
