BD9018347
3,5-Dichloro-2,6-difluoropyridin-4-amine , 98% , 2840-00-8
CAS NO.:2840-00-8
Empirical Formula: C5H2Cl2F2N2
Molecular Weight: 198.99
MDL number: MFCD08443598
EINECS: 220-630-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.80 | In Stock |
|
| 5g | RMB125.60 | In Stock |
|
| 25g | RMB459.20 | In Stock |
|
| 100g | RMB1513.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-114 °C(lit.) |
| Boiling point: | 112-113 °C |
| Density | 1.697±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -3.04±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C5H2Cl2F2N2/c6-1-3(10)2(7)5(9)11-4(1)8/h(H2,10,11) |
| InChIKey | BEGINUFBBRTGBH-UHFFFAOYSA-N |
| SMILES | C1(F)=NC(F)=C(Cl)C(N)=C1Cl |
| CAS DataBase Reference | 2840-00-8(CAS DataBase Reference) |
| EPA Substance Registry System | 4-Pyridinamine, 3,5-dichloro-2,6-difluoro- (2840-00-8) |
Description and Uses
4-Amino-3,5-dichlorodifluoropyridine, is an intermediate in the synthesis of many chemical compounds, such as Fluroxypyr Ethyl Ester, and Fluroxypyr (F598780).
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H312-H411 |
| Precautionary statements | P264-P270-P273-P280-P301+P310-P302+P352-P312-P322-P330-P363-P391-P501 |
| Hazard Codes | Xn,N,Xi |
| Risk Statements | 21/22-51/53-36/37/38 |
| Safety Statements | 36/37-61-36-26 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |







