BD9066947
2-Chloro-1-(pyrrolidin-1-yl)ethanone , 98% , 20266-00-6
CAS NO.：20266-00-6
Empirical Formula: C6H10ClNO
Molecular Weight: 147.6
MDL number: MFCD01217237
EINECS: 243-658-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB96.80 | In Stock |
|
| 5g | RMB164.80 | In Stock |
|
| 25g | RMB706.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 46-47°C |
| Boiling point: | 105°C/1.3mmHg(lit.) |
| Density | 1.205±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| pka | -0.95±0.20(Predicted) |
| form | powder to lump |
| color | White to Orange to Green |
| InChI | InChI=1S/C6H10ClNO/c7-5-6(9)8-3-1-2-4-8/h1-5H2 |
| InChIKey | AAOSLLBWWRKJIR-UHFFFAOYSA-N |
| SMILES | C(=O)(N1CCCC1)CCl |
| CAS DataBase Reference | 20266-00-6(CAS DataBase Reference) |
Description and Uses
1-(Chloroacetyl)pyrrolidine acts as a useful reagent in the synthesis of celastrol derivatives with potentials as anticancer agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22-20/21/22 |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
