BD9099631
4-Bromo-2-fluoro-6-nitrotoluene , 98% , 502496-34-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB24.00 | In Stock |
|
| 250mg | RMB28.80 | In Stock |
|
| 1g | RMB92.80 | In Stock |
|
| 5g | RMB313.60 | In Stock |
|
| 10g | RMB530.40 | In Stock |
|
| 25g | RMB1113.60 | In Stock |
|
| 100g | RMB3022.40 | In Stock |
|
| 500g | RMB11183.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 261.7±35.0 °C(Predicted) |
| Density | 1.696±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | crystalline powder |
| color | Lemon tiny fused crystals/chunks |
| InChI | InChI=1S/C7H5BrFNO2/c1-4-6(9)2-5(8)3-7(4)10(11)12/h2-3H,1H3 |
| InChIKey | QZUIGBPWEFMEEV-UHFFFAOYSA-N |
| SMILES | C1(F)=CC(Br)=CC([N+]([O-])=O)=C1C |
Description and Uses
4-Bromo-2-fluoro-6-nitrotoluene is a fluorinated brominated aromatic intermediate, mainly used in the synthesis of pharmaceutical APIs and pesticides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P280-P309+P311 |
| Hazard Codes | Xi,Xn |
| Hazard Note | Irritant |
| HS Code | 2904990090 |





