PRODUCT Properties
| Melting point: | 105°C |
| Boiling point: | 250 °C / 19mmHg |
| Density | 1.0717 (rough estimate) |
| refractive index | 1.6700 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) |
| form | Solid |
| color | Off-White to Pale Beige |
| BRN | 2054097 |
| InChI | InChI=1S/C20H14O/c1-3-7-17-13-19(11-9-15(17)5-1)21-20-12-10-16-6-2-4-8-18(16)14-20/h1-14H |
| InChIKey | DZRLNYVDCIYXPG-UHFFFAOYSA-N |
| SMILES | O(C1=CC=C2C(=C1)C=CC=C2)C1=CC=C2C(=C1)C=CC=C2 |
| CAS DataBase Reference | 613-80-9(CAS DataBase Reference) |
Description and Uses
2,2''-Dinaphthyl Ether and ethers exhibit antifungal activity against A. niger, A. flavus, A. alternata and F. oxysporum.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| HS Code | 29029090 |
