BD9378231
4-Chloronicotinonitrile , 95% , 89284-61-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB66.40 | In Stock |
|
| 250mg | RMB94.40 | In Stock |
|
| 1g | RMB242.40 | In Stock |
|
| 5g | RMB968.80 | In Stock |
|
| 10g | RMB1792.00 | In Stock |
|
| 25g | RMB3907.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86 °C |
| Boiling point: | 243.6±20.0 °C(Predicted) |
| Density | 1.33±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| pka | 1.11±0.10(Predicted) |
| Appearance | Off-white to yellow Solid |
| InChI | InChI=1S/C6H3ClN2/c7-6-1-2-9-4-5(6)3-8/h1-2,4H |
| InChIKey | QBKPXDUZFDINDV-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(Cl)=C1C#N |
| CAS DataBase Reference | 89284-61-7(CAS DataBase Reference) |
Description and Uses
4-Chloro-3-pyridinecarbonitrile is used in the preparation of heteroaryl urea inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H332-H319-H335-H315-H302-H312 |
| Precautionary statements | P261-P271-P304+P340-P312-P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P-P280-P302+P352-P312-P322-P363-P501-P264-P280-P302+P352-P321-P332+P313-P362 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
