BD9502447
1,2-Bis((2R,5R)-2,5-diisopropylphospholan-1-yl)benzene , 98% , 136705-65-2
Synonym(s):
(R,R)-i-Pr-DUPHOS
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB799.20 | In Stock |
|
| 250mg | RMB1445.60 | In Stock |
|
| 1g | RMB3904.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 40°C |
| alpha | +85° (c 1, hexane) |
| Boiling point: | 502.0±20.0 °C(Predicted) |
| refractive index | n20/D 1.5701 |
| Flash point: | >110°(230°F) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | crystal |
| color | white |
| optical activity | [α]20/D +103°, c = 1 in chloroform |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C26H44P2/c1-17(2)21-13-14-22(18(3)4)27(21)25-11-9-10-12-26(25)28-23(19(5)6)15-16-24(28)20(7)8/h9-12,17-24H,13-16H2,1-8H3/t21-,22-,23-,24-/m1/s1 |
| InChIKey | RBVGOQHQBUPSGX-MOUTVQLLSA-N |
| SMILES | C1(P2[C@@H](C(C)C)CC[C@@H]2C(C)C)=CC=CC=C1P1[C@@H](C(C)C)CC[C@@H]1C(C)C |
Description and Uses
It is used as ligands like DuPhos and BPE ligands and are highly efficient privileged ligands.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
