BD9541355
2-(tert-Butyl)cyclohexylacetate , 99% , 88-41-5
CAS NO.:88-41-5
Empirical Formula: C12H22O2
Molecular Weight: 198.3
MDL number: MFCD00027397
EINECS: 201-828-7
| Pack Size | Price | Stock | Quantity |
| 25g | RMB47.20 | In Stock |
|
| 100g | RMB148.80 | In Stock |
|
| 500g | RMB504.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 221 °C(lit.) |
| Density | 0.9590 (rough estimate) |
| refractive index | 1.4720 (estimate) |
| Flash point: | >194 °F |
| storage temp. | Store at room temperature |
| solubility | Almost insoluble in water, poorly soluble in Propylene glycol, soluble in alcohol and oils. |
| Odor | at 100.00 %. fruity woody green apple herbal |
| Appearance | Colorless to off-white Liquid |
| Odor Type | fruity |
| Cosmetics Ingredients Functions | PERFUMING FRAGRANCE |
| InChI | InChI=1S/C12H22O2/c1-9(13)14-11-8-6-5-7-10(11)12(2,3)4/h10-11H,5-8H2,1-4H3 |
| InChIKey | FINOAUDUYKVGDS-UHFFFAOYSA-N |
| SMILES | C1(OC(=O)C)CCCCC1C(C)(C)C |
| LogP | 4.230 |
| CAS DataBase Reference | 88-41-5(CAS DataBase Reference) |
| EPA Substance Registry System | 2-tert-Butylcyclohexyl acetate (88-41-5) |
Description and Uses
Verdox is used in preparation method of Sodium Bicarbonate injection.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 1 |
| RTECS | GV8962500 |






