tert-Butyl1-amino-3,6,9,12,15-pentaoxaoctadecan-18-oate , 98% , 1446282-18-3
Synonym(s):
tert-Butyl-1-amino-3,6,9,12,15-pentaoxaoctadecan-18-oate;H2N-PEG5-CH2CH2COOtBu
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB289.60 | In Stock |
|
| 250mg | RMB492.00 | In Stock |
|
| 1g | RMB1328.00 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Boiling point: | 439.1±40.0 °C(Predicted) |
| Density | 1.049±0.06 g/cm3(Predicted) |
| refractive index | n/D 1.4534 |
| storage temp. | -20°C |
| solubility | Soluble in Water, DMSO, DCM, DMF |
| pka | 8.74±0.10(Predicted) |
| form | viscous liquid |
| color | Light yellowish |
| SMILES | NCCOCCOCCOCCOCCOCCC(OC(C)(C)C)=O |
Description and Uses
Amino-PEG5-t-butyl ester is a PEG molecule consisting of an amino group and a t-butyl protected carboxyl group. The amino group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The t-butyl protected carboxyl group can be deprotected under acidic conditions.The hydrophilic PEG spacer increases solubility in aqueous media.
This heterobifunctional, PEGylated crosslinker features an amino group at one end and t-butyl-protected carboxyl group at the other, which can be deprotected with acidic conditions. The hydrophillic PEG linker facilitates solubility in biological applications. Amino-PEG5-t-butyl ester can be used for bioconjugation or as a building block for synthesis of small molecules, conjugates of small molecules and/or biomolecules, or other tool compounds for chemical biology and medicinal chemistry that require ligation. Examples of applications include its synthetic incorporation into antibody-drug conjugates or proteolysis-targeting chimeras (PROTAC? molecules) for targeted protein degradation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P261 |
| WGK Germany | WGK 3 |
| HS Code | 2942000090 |
| Storage Class | 10 - Combustible liquids |




![3-[2-(2-Aminoethoxy)ethoxy]propanoic acid 1,1-dimethylethyl ester](https://img.chemicalbook.com/CAS/20150408/GIF/756525-95-8.gif)


