BD9596255
trans-2-[3-(4-tert-Butylphenyl)-2-methyl-2-propenylidene]malononitrile , 98% , 300364-84-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1016.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 123-126 °C |
| Boiling point: | 392.5±37.0 °C(Predicted) |
| Density | 1.029±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| BRN | 8913051 |
| Stability: | Light Sensitive |
| InChI | 1S/C17H18N2/c1-13(10-15(11-18)12-19)9-14-5-7-16(8-6-14)17(2,3)4/h5-10H,1-4H3/b13-9+ |
| InChIKey | OIASAVWSBWJWBR-UKTHLTGXSA-N |
| SMILES | CC(=C/c1ccc(cc1)C(C)(C)C)\C=C(\C#N)C#N |
| Absorption | >2000 at 337nm (mol. absorption) |
Description and Uses
trans-2-[3-(4-tert-Butylphenyl)-2-methyl-2-propenylidene]malononitrile is a useful compound with applications in drug delivery.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| F | 9 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |

![trans-2-[3-(4-tert-Butylphenyl)-2-methyl-2-propenylidene]malononitrile](https://img.chemicalbook.com/CAS/GIF/300364-84-5.gif)



