BD9620047
8-Bromo-1,6-naphthyridin-2(1H)-one , 98% , 902837-41-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB500.00 | In Stock |
|
| 1g | RMB1252.00 | In Stock |
|
| 5g | RMB5633.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 412.1±45.0 °C(Predicted) |
| Density | 1.711±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen |
| pka | 9.95±0.20(Predicted) |
| form | solid |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C8H5BrN2O/c9-6-4-10-3-5-1-2-7(12)11-8(5)6/h1-4H,(H,11,12) |
| InChIKey | QDOLSUHXUOKZJY-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=NC=C2Br)C=CC1=O |
| CAS DataBase Reference | 902837-41-6 |
Description and Uses
8-Bromo-1,6-naphthyridin-2(1H)-one is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P301+P312+P330-P304+P340+P312-P305+P351+P338-P337+P313 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





