BD9628655
3-Amino-2-methoxybenzoicacid , 98% , 861306-04-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB103.20 | In Stock |
|
| 1g | RMB277.60 | In Stock |
|
| 5g | RMB923.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-102 °C |
| Boiling point: | 353.3±27.0 °C(Predicted) |
| Density | 1.303±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.23±0.10(Predicted) |
| color | White to Brown |
| InChI | InChI=1S/C8H9NO3/c1-12-7-5(8(10)11)3-2-4-6(7)9/h2-4H,9H2,1H3,(H,10,11) |
| InChIKey | ZBQFWVIYNLHFMO-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(N)=C1OC |
Description and Uses
3-Amino-2-methoxybenzoic acid is used in peptide synthesis and assay.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P501-P270-P264-P301+P312+P330 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| HS Code | 2916399090 |






![Methyl3,4-dihydro-2H-benzo[b][1,4]oxazine-8-carboxylatehydrochloride](https://img.chemicalbook.com/CAS/GIF/873862-33-0.gif)