BD9668855
2-(Oxiran-2-ylmethyl)isoindoline-1,3-dione , 95+% , 5455-98-1
Synonym(s):
N-Glycidylphthalimide
CAS NO.:5455-98-1
Empirical Formula: C11H9NO3
Molecular Weight: 203.19
MDL number: MFCD00005896
EINECS: 226-710-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB88.00 | In Stock |
|
| 25g | RMB300.00 | In Stock |
|
| 100g | RMB796.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-98 °C(lit.) |
| Boiling point: | 341.49°C (rough estimate) |
| Density | 1.2621 (rough estimate) |
| refractive index | 1.4950 (estimate) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Crystalline Powder |
| pka | -2.24±0.20(Predicted) |
| color | White to pale yellow |
| BRN | 171277 |
| InChI | 1S/C11H9NO3/c13-10-8-3-1-2-4-9(8)11(14)12(10)5-7-6-15-7/h1-4,7H,5-6H2 |
| InChIKey | DUILGEYLVHGSEE-UHFFFAOYSA-N |
| SMILES | O=C1N(CC2CO2)C(=O)c3ccccc13 |
| CAS DataBase Reference | 5455-98-1(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Isoindole-1,3(2H)-dione, 2-(oxiranylmethyl)- (5455-98-1) |
Description and Uses
N-(2,3-Epoxypropyl)phthalimide is a reagent used for the simultaneous preparation of a primary amine and secondary alcohol.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 26-39 |
| WGK Germany | 2 |
| RTECS | TI4950000 |
| F | 21 |
| TSCA | TSCA listed |
| HS Code | 29251900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 |
| Hazardous Substances Data | 5455-98-1(Hazardous Substances Data) |





![2,6-DI(OXIRAN-2-YLMETHYL)-1,2,3,5,6,7-HEXAHYDROPYRROLO[3,4-F]ISOINDOLE-1,3,5,7-TETRAONE](https://img.chemicalbook.com/CAS/GIF/23328-66-7.gif)