BD9730547
(S)-2,3-Dihydro-1H-inden-1-ol , 98% , 25501-32-0
Synonym(s):
(S)-(+)-1-Hydroxyindan
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB508.00 | In Stock |
|
| 250mg | RMB956.00 | In Stock |
|
| 1g | RMB2929.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69-73 °C (lit.) |
| alpha | 30 º (c=2 in chloroform) |
| Boiling point: | 210 °C(Press: 5 Torr) |
| Density | 1.161±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| pka | 14.23±0.20(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | [α]20/D +30°, c = 2 in chloroform |
| BRN | 2206709 |
| InChI | InChI=1S/C9H10O/c10-9-6-5-7-3-1-2-4-8(7)9/h1-4,9-10H,5-6H2/t9-/m0/s1 |
| InChIKey | YIAPLDFPUUJILH-VIFPVBQESA-N |
| SMILES | [C@@H]1(O)C2=C(C=CC=C2)CC1 |
Description and Uses
(S)?-?(+)?-?1-?Indanol is a building block used in pharmaceutical synthesis such as orally bioavailable GPR40 agonists such as DS-1558 used to stimulate insulin secretion.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2906290090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






