BD9745947
                    N-((S)-1-(((R)-1-Hydroxy-3-methylbutyl)amino)-1-oxo-3-phenylpropan-2-yl)pyrazine-2-carboxamide , 95+% , 289472-78-2
| Pack Size | Price | Stock | Quantity | 
| 1g | RMB4300.80 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Boiling point: | 672.0±55.0 °C(Predicted) | 
                                    
| Density | 1.199±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | 2-8°C | 
                                    
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | 
                                    
| pka | 11.90±0.46(Predicted) | 
                                    
| form | Solid | 
                                    
| color | White to Off-White | 
                                    
| InChIKey | NEIDLJIPMZVISC-DOTOQJQBSA-N | 
                                    
| SMILES | C1(C(N[C@@H](CC2=CC=CC=C2)C(N[C@H](O)CC(C)C)=O)=O)=NC=CN=C1 | 
                                    
Description and Uses
(R)-Hydroxy Des(boric acid) Bortezomib is an impurity in the synthesis of Bortezomib (B675700), the first proteasome inhibitor to be approved by the US FDA for multiple myeloma, a blood cancer. A reversible inhibitor of the 26S proteasome-a barrel-shaped multiprotein particle found in the nucleus and cytosol of all eukaryotic cells. Targets the ubiquitin-proteasome pathway.






