LN1763753
                    98% , 886979-81-3
CAS NO.:886979-81-3
Empirical Formula: C19H24N4O4
Molecular Weight: 372.42
MDL number:
EINECS: 816-338-4
| Pack Size | Price | Stock | Quantity | 
| 5mg | RMB22792.00 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 139-142°C | 
                                    
| Boiling point: | 709.0±60.0 °C(Predicted) | 
                                    
| Density | 1.227±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | -20°C Freezer | 
                                    
| solubility | Chloroform (Slightly), DMSO (Slightly) | 
                                    
| pka | 10.96±0.10(Predicted) | 
                                    
| form | Solid | 
                                    
| color | White | 
                                    
| Stability: | Unstable in Methanol | 
                                    
| InChIKey | ATPZUYZYORUVIK-RDJZCZTQSA-N | 
                                    
| SMILES | C1(C(N[C@@H](CC2=CC=CC=C2)C(N[C@@H](OO)CC(C)C)=O)=O)=NC=CN=C1 | 
                                    
Description and Uses
(S,S)-Hydroperoxy Des(boric Acid) Bortezomib is an impurity of Bortezomib (B675700), the first proteasome inhibitor to be approved by the US FDA for multiple myeloma, a blood cancer
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS08,GHS09,GHS06  | 
                                    
| Signal word | Danger | 
| Hazard statements | H315-H411-H319-H361-H372-H300 | 
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P-P201-P202-P281-P308+P313-P405-P501-P260-P264-P270-P314-P501-P264-P270-P301+P310-P321-P330-P405-P501 | 









