BD9767055
1,2,3-Tris(2-cyanoethoxy)propane , 95% , 2465-93-2
CAS NO.:2465-93-2
Empirical Formula: C12H17N3O3
Molecular Weight: 251.28
MDL number: MFCD00019868
EINECS: 219-573-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB79.20 | In Stock |
|
| 25g | RMB244.00 | In Stock |
|
| 100g | RMB708.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 394.44°C (rough estimate) |
| Density | 1.11 |
| refractive index | 1.4600 to 1.4640 |
| Flash point: | >93.33 °C |
| storage temp. | Storage temp. 2-8°C |
| form | Liquid |
| color | White to Yellow to Green |
| Specific Gravity | 1.107 |
| Water Solubility | Soluble in water. |
| InChI | InChI=1S/C12H17N3O3/c13-4-1-7-16-10-12(18-9-3-6-15)11-17-8-2-5-14/h12H,1-3,7-11H2 |
| InChIKey | ALGVJKNIAOBBBJ-UHFFFAOYSA-N |
| SMILES | C(OCCC#N)C(OCCC#N)COCCC#N |
| CAS DataBase Reference | 2465-93-2(CAS DataBase Reference) |
| EPA Substance Registry System | Propanenitrile, 3,3',3''-[1,2,3-propanetriyltris(oxy)]tris- (2465-93-2) |
Description and Uses
1,2,3-Tris(2-cyanoethoxy)propane could be used as the stationary phase in gas-liquid chromatography.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H312-H331 |
| Precautionary statements | P261-P280h-P304+P340-P311a-P405-P501a |
| Safety Statements | 24/25 |
| RIDADR | UN3276 |
| TSCA | TSCA listed |
| HS Code | 2926.90.5050 |
| HazardClass | 6.1 |
| PackingGroup | II |






