BD9795155
4-(((S)-1-(((S)-1-(((S)-1-((4-Nitrophenyl)amino)-1-oxopropan-2-yl)amino)-1-oxopropan-2-yl)amino)-1-oxopropan-2-yl)amino)-4-oxobutanoicacid , 95% , 52299-14-6
Synonym(s):
Elastase Substrate VIII, Colorimetric - CAS 52299-14-6 - Calbiochem;N-Succinyl-L -alanyl-L -alanyl-L -alanine 4-nitroanilide;N-Succinyl-tri-L -alanine 4-nitroanilide
CAS NO.:52299-14-6
Empirical Formula: C19H25N5O8
Molecular Weight: 451.43
MDL number: MFCD00036774
EINECS: 257-823-5
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB668.00 | In Stock |
|
| 100mg | RMB1068.00 | In Stock |
|
| 250mg | RMB1814.40 | In Stock |
|
| 1g | RMB4898.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 923.5±65.0 °C(Predicted) |
| Density | 1.370±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMF: 3 mg/ml; DMSO: 5 mg/ml; Ethanol: Slightly soluble; PBS (pH 7.2): 0.3 mg/ml |
| pka | 4.69±0.10(Predicted) |
| form | White to off-white solid |
| color | white to off-white |
| BRN | 2928351 |
| Sequence | {Suc}-Ala-Ala-Ala-{pNA} |
| InChIKey | GVUGADOWXGKRAE-SRVKXCTJSA-N |
| SMILES | [N+](=O)([O-])c1ccc(cc1)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CCC(=O)O)C)C)C |
Description and Uses
Substrate for Elastase.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 8-10-21 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |






