BD9869247
1,3-Bis(4-nitrophenyl)urea , 98% , 587-90-6
Synonym(s):
4′,4′′-Dinitrocarbanilide
CAS NO.:587-90-6
Empirical Formula: C13H10N4O5
Molecular Weight: 302.24
MDL number: MFCD00024602
EINECS: 209-607-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB267.20 | In Stock |
|
| 5g | RMB934.40 | In Stock |
|
| 25g | RMB3268.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Boiling point: | 443.29°C (rough estimate) |
| Density | 1.3627 (rough estimate) |
| refractive index | 1.6120 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMF (Slightly), DMSO (Slightly, Heated) |
| form | Solid |
| pka | 12.44±0.70(Predicted) |
| color | Yellow |
| Merck | 14,3278 |
| BRN | 2225762 |
| InChI | 1S/C13H10N4O5/c18-13(14-9-1-5-11(6-2-9)16(19)20)15-10-3-7-12(8-4-10)17(21)22/h1-8H,(H2,14,15,18) |
| InChIKey | JEZZOKXIXNSKQD-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(NC(=O)Nc2ccc(cc2)[N+]([O-])=O)cc1 |
| CAS DataBase Reference | 587-90-6(CAS DataBase Reference) |
| EPA Substance Registry System | Urea, N,N'-bis(4-nitrophenyl)- (587-90-6) |
Description and Uses
1,3-Bis(4-nitrophenyl)urea is the active component of the antifertility agent nicarbazin, in chicken, duck, and goose plasma.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2921490090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






