BD9888755
2-Amino-5-chlorophenol , 97% , 28443-50-7
CAS NO.:28443-50-7
Empirical Formula: C6H6ClNO
Molecular Weight: 143.57
MDL number: MFCD02093863
EINECS: 249-020-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB298.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 145-153 °C (lit.) |
| Boiling point: | 185.5°C (rough estimate) |
| Density | 1.2028 (rough estimate) |
| vapor pressure | 0.002-0.094Pa at 20-50℃ |
| refractive index | 1.5618 (estimate) |
| storage temp. | -20°C, stored under nitrogen |
| solubility | soluble in Methanol |
| pka | 8.79±0.10(Predicted) |
| form | Powder |
| color | Light brown |
| InChI | InChI=1S/C6H6ClNO/c7-4-1-2-5(8)6(9)3-4/h1-3,9H,8H2 |
| InChIKey | FZCQMIRJCGWWCL-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(Cl)=CC=C1N |
| CAS DataBase Reference | 28443-50-7(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol, 2-amino-5-chloro- (28443-50-7) |
Description and Uses
2-Amino-5-chlorophenol may be used to synthesize 2-amino-5-chloromuconic semialdehyde and benzoxazole derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




