BD9903831
5-Bromo-2-methoxypyridin-3-amine , 98% , 884495-39-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB65.60 | In Stock |
|
| 10g | RMB120.80 | In Stock |
|
| 25g | RMB293.60 | In Stock |
|
| 100g | RMB1145.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 53-55℃ |
| Boiling point: | 284.5±35.0 °C(Predicted) |
| Density | 1.622±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 1.98±0.20(Predicted) |
| Appearance | Off-white to light brown Solid |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C6H7BrN2O/c1-10-6-5(8)2-4(7)3-9-6/h2-3H,8H2,1H3 |
| InChIKey | HJOOFLFWIISCAI-UHFFFAOYSA-N |
| SMILES | C1(OC)=NC=C(Br)C=C1N |
Description and Uses
3-Amino-5-bromo-2-methoxypyridine is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41-43 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
