BD9930655
Sodium5-hydroxy-4-((2-hydroxybenzylidene)amino)-7-sulfonaphthalene-2-sulfonatexhydrate , 97% , 206752-32-1
CAS NO.：206752-32-1
Empirical Formula: C17H13NNaO8S2
Molecular Weight: 446.407
MDL number: MFCD00149588
EINECS: 681-544-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5g | RMB107.20 | In Stock |
|
| 25g | RMB373.60 | In Stock |
|
| 100g | RMB1231.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| storage temp. | room temp |
| solubility | NaOH: soluble5%, clear to hazy, yellow to brown |
| form | powder |
| color | Orange |
| Water Solubility | Soluble in water, ethanol and acetone. |
| λmax | 340-344 nm |
| BRN | 4100175 |
| InChIKey | AAIGDXDVSZJVSW-IFJQNBRBSA-M |
| SMILES | C12=C(O)C=C(S(=O)(=O)O)C=C1C=C(S([O-])(=O)=O)C=C2/N=C/C1C=CC=CC=1O.O.[Na+] |
Description and Uses
Azomethine-H monosodium salt hydrate is a reagent used for the colorimetric determination of boron in soil, plants, composts, manure, water and nutrient solutions.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29252900 |
