F037623
N,N-Dimethylformamide dibenzyl acetal , Null , 2016-04-8
CAS NO.：2016-04-8
Empirical Formula: C17H21NO2
Molecular Weight: 271.35
MDL number: MFCD00014869
EINECS: 217-946-7
| Pack Size | Price | Stock | Quantity |
| 2g | RMB435.20 | In Stock |
|
| 10g | RMB1824.80 | In Stock |
|
| 50g | RMB7437.60 | In Stock |
|
| 250g | RMB28056.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 118-120 °C(lit.) |
| Density | 1.045 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 212 °F |
| solubility | Soluble in variety of inert solvents. |
| pka | 5.07±0.50(Predicted) |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C17H21NO2/c1-18(2)17(19-13-15-9-5-3-6-10-15)20-14-16-11-7-4-8-12-16/h3-12,17H,13-14H2,1-2H3 |
| InChIKey | JFIKHFNGAURIIB-UHFFFAOYSA-N |
| SMILES | C(OCC1=CC=CC=C1)(OCC1=CC=CC=C1)N(C)C |
| CAS DataBase Reference | 2016-04-8(CAS DataBase Reference) |
Description and Uses
N,N-Dimethylformamide diethyl acetal was used in quantification of cocaine and its primary metabolite, benzoyl ecgonine from urine matrix by gas chromatography.
Safety
| Symbol(GHS) |  GHS07 |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-21 |
