F138922
Pentamethylcyclopentadienylzirconium trichloride , 99 , 75181-07-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1256.00 | In Stock |
|
| 5g | RMB6300.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230 °C (dec.) (lit.) |
| storage temp. | -20°C |
| form | crystal |
| color | pale yellow |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C10H15.3ClH.Zr/c1-6-7(2)9(4)10(5)8(6)3;;;;/h1-5H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | FOKGVHRHBBEPPI-UHFFFAOYSA-K |
| SMILES | Cl[Zr](Cl)Cl.C[C]1[C](C)[C](C)[C](C)[C]1C |
| CAS DataBase Reference | 75181-07-6(CAS DataBase Reference) |
Description and Uses
Catalyst for:
Cross-coupling reaction of aryl fluorides with phenethyl Grignard reagents
Living polymerizations of propylene
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
