F181023
Methyl 3-aminosalicylate , 97 , 35748-34-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1848.00 | In Stock |
|
| 5g | RMB10312.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120℃ (dichloromethane ) |
| Boiling point: | 274.9±25.0 °C(Predicted) |
| Density | 1.305±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform, DMSO, Methanol |
| form | Solid |
| pka | 9.55±0.10(Predicted) |
| color | Light Brown |
| InChI | InChI=1S/C8H9NO3/c1-12-8(11)5-3-2-4-6(9)7(5)10/h2-4,10H,9H2,1H3 |
| InChIKey | OMWQHVRUXLRZRC-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=CC(N)=C1O |
Description and Uses
3-Amino-2-hydroxybenzoic Acid Methyl Ester is disubsituted benzoic acid used in the preparation of various pharmaceutical compounds such as sphingosine kinase inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| HS Code | 2922500090 |




![Methyl3,4-dihydro-2H-benzo[b][1,4]oxazine-8-carboxylatehydrochloride](https://img.chemicalbook.com/CAS/GIF/873862-33-0.gif)
