F423523
3-Chloro-4-fluoro-5-nitrobenzotrifluoride , 98 , 101646-02-0
CAS NO.：101646-02-0
Empirical Formula: C7H2ClF4NO2
Molecular Weight: 243.54
MDL number: MFCD00674108
| Pack Size | Price | Stock | Quantity |
| 1g | RMB490.40 | In Stock |
|
| 5g | RMB1156.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 200 °C (lit.) |
| Density | 1.607 g/mL at 25 °C (lit.) |
| refractive index | 1.482 |
| Flash point: | 113 °C |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| color | Clear |
| BRN | 5436538 |
| InChI | 1S/C7H2ClF4NO2/c8-4-1-3(7(10,11)12)2-5(6(4)9)13(14)15/h1-2H |
| InChIKey | JVOKKJHIEVEFEB-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(cc(Cl)c1F)C(F)(F)F |
| CAS DataBase Reference | 101646-02-0(CAS DataBase Reference) |
Description and Uses
3-Chloro-4-fluoro-5-nitrobenzotrifluoride can be used as pyrolyl-tRNA synthetase inhibitors. It can also be used to treat various diseases, including nervous and mental disorders and inflammatory diseases, caused by abnormal intracellular signaling, that can include acetylcholine.
Safety
| Symbol(GHS) |   GHS06,GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H311-H332-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280h-P309-P310 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 36/37/39-45-36-26 |
| RIDADR | 2306 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2904990090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
