F666129
4-Bromo-D-phenylalanine , 95 , 62561-74-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB292.80 | In Stock |
|
| 1g | RMB880.00 | In Stock |
|
| 5g | RMB3508.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 368.4±32.0 °C(Predicted) |
| Density | 1.588±0.06 g/cm3(Predicted) |
| storage temp. | Store at RT. |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 2.18±0.10(Predicted) |
| Appearance | Off-white to yellow Solid |
| InChI | InChI=1S/C9H10BrNO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m1/s1 |
| InChIKey | PEMUHKUIQHFMTH-MRVPVSSYSA-N |
| SMILES | C(O)(=O)[C@@H](CC1=CC=C(Br)C=C1)N |
| CAS DataBase Reference | 62561-74-4(CAS DataBase Reference) |
Description and Uses
4-Bromo-D-phenylalanine serves as a gramicidin S analogue residue that exhibits β-sheet formation and antimicrobial activities closely related to native gramicidin S. The Fmoc-protected derivative functions as a coupling component in solid-phase peptide synthesis, incorporated into sequences such as cyclo-(MAA-Val-Orn(Boc)-Leu-DPhe-Pro-Val-Orn-Leu) and resin-bound SAA(Piv)-Val-Orn(Boc)-Leu-DPhe-Pro-Val-Orn(Boc)-Leu[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| HS Code | 2922498590 |






