F712029
3-Chloropropionaldehyde diethyl acetal , 90+ , 35573-93-4
Synonym(s):
3-Chloro-1,1-diethoxypropane
CAS NO.:35573-93-4
Empirical Formula: C7H15ClO2
Molecular Weight: 166.65
MDL number: MFCD00000994
EINECS: 252-623-4
| Pack Size | Price | Stock | Quantity |
| 25g | RMB1896.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 84 °C25 mm Hg(lit.) |
| Density | 0.995 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 98 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Soluble), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless to Off-White |
| BRN | 1698609 |
| InChI | InChI=1S/C7H15ClO2/c1-3-9-7(5-6-8)10-4-2/h7H,3-6H2,1-2H3 |
| InChIKey | NXHONHDWVLPPCS-UHFFFAOYSA-N |
| SMILES | C(OCC)(OCC)CCCl |
| CAS DataBase Reference | 35573-93-4(CAS DataBase Reference) |
| NIST Chemistry Reference | «beta»-Chloropropionaldehyde diethyl acetal(35573-93-4) |
Description and Uses
3-Chloropropionaldehyde diethylacetal has been used in the synthesis of:
- N-[4-[[3-(2, 4-diamino-1,6-dihydro-6-oxo-5-pyrimidinyl)propyl]amino]benzoyl]-L-glutamic acid, an acyclic analog of 5,6,7,8-tetrahydrofolic acid
- 1-(D,L)-(3′-amino, 3′-carboxypropyl)uracil, nucleoamino acid
- 7-methoxychromanone
- grignard reagent
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210-P370+P378 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36-16 |
| RIDADR | UN 1989 3/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29091990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |



![N,N-Dimethylformamide Dipropyl Acetal [for Esterification]](https://img.chemicalbook.com/CAS/GIF/6006-65-1.gif)

