F733629
Diethyl tert-butylmalonate , 97 , 759-24-0
CAS NO.：759-24-0
Empirical Formula: C11 H20 O4
Molecular Weight: 216.27
MDL number: MFCD00009152
EINECS: 212-067-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB442.40 | In Stock |
|
| 5g | RMB1608.00 | In Stock |
|
| 25g | RMB7024.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 102-104 °C/11 mmHg (lit.) |
| Density | 1.014 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 195 °F |
| form | liquid |
| pka | 13.74±0.46(Predicted) |
| Water Solubility | Immiscible with water. |
| BRN | 1781709 |
| InChI | 1S/C11H20O4/c1-6-14-9(12)8(11(3,4)5)10(13)15-7-2/h8H,6-7H2,1-5H3 |
| InChIKey | RJNICNBRGVKNSR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)C(C)(C)C |
Description and Uses
Diethyl tert-butylmalonate is used in the preparation of enantiomers of 4-tert-butyl-3-isopropyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane 1-sulfide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |
