PRODUCT Properties
| Melting point: | 87-90 °C(lit.) |
| Boiling point: | 192 °C735 mm Hg(lit.) |
| Density | 1.6820 (estimate) |
| Flash point: | 95°C/20mm |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 12.88±0.10(Predicted) |
| color | Off-White |
| BRN | 1810012 |
| InChI | 1S/C10H3F19O/c11-2(12,1-30)3(13,14)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)9(25,26)10(27,28)29/h30H,1H2 |
| InChIKey | NIRPXSQCRWXHNZ-UHFFFAOYSA-N |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 307-37-9(CAS DataBase Reference) |
| EPA Substance Registry System | 9:1 Fluorotelomer alcohol (307-37-9) |
Description and Uses
1H,1H-Perfluoro-1-decanol can be introduced into esterifying moiety of bacteriochlorophyll c in green sulfur photosynthetic bacterium Chlorobaculum tepidum by pigment biosynthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P501-P270-P264-P301+P312+P330 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29081990 |
| Storage Class | 11 - Combustible Solids |
