F920221
4',5-Dihydroxy-7-methoxyflavone , 97 , 437-64-9
Synonym(s):
4′,5-Dihydroxy-7-methoxyflavone;5-Hydroxy-2-(4-hydroxyphenyl)-7-methoxy-4H-1-benzopyran-4-one;7-O-Methylapigenin;Apigenin 7-O-methyl ether;Puddumetin
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB1012.00 | In Stock |
|
| 100mg | RMB3073.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 290-292°C |
| Boiling point: | 546.5±50.0 °C(Predicted) |
| Density | 1.420 |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | Acetone (Very Slightly, Sonicated), DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 6.36±0.40(Predicted) |
| form | powder |
| color | Orange |
| BRN | 292549 |
| Stability: | Hygroscopic |
| Major Application | food and beverages |
| InChI | InChI=1S/C16H12O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
| InChIKey | JPMYFOBNRRGFNO-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(O)C=C2)OC2=CC(OC)=CC(O)=C2C(=O)C=1 |
| LogP | 2.360 (est) |
| CAS DataBase Reference | 437-64-9(CAS DataBase Reference) |
Description and Uses
An antitumor constituent from the leaves of Aquilaria sinensis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P301+P312+P330-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-24/25-22-37 |
| WGK Germany | WGK 3 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |







