LN-149314
Doxefazepam , 99.9% , 40762-15-0
CAS NO.:40762-15-0
Empirical Formula: C17H14ClFN2O3
Molecular Weight: 348.76
MDL number: MFCD00868036
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 138-140° |
| Boiling point: | 204.52°C (rough estimate) |
| Density | 1.3534 (estimate) |
| storage temp. | Store at -20°C |
| pka | 11.55±0.40(Predicted) |
| form | Solid |
| color | White to off-white |
| InChI | InChI=1S/C17H14ClFN2O3/c18-10-5-6-14-12(9-10)15(11-3-1-2-4-13(11)19)20-16(23)17(24)21(14)7-8-22/h1-6,9,16,22-23H,7-8H2 |
| InChIKey | VOJLELRQLPENHL-UHFFFAOYSA-N |
| SMILES | N1(CCO)C2=CC=C(Cl)C=C2C(C2=CC=CC=C2F)=NC(O)C1=O |
| IARC | 3 (Vol. 66) 1996 |
Description and Uses
Doxefazepam is a benzodiazepine hypnotic somewhat more potent than flurazepam.
Safety
| RIDADR | 3249 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Toxicity | LD50 in rats, mice (mg/kg): 2550, >1500 orally; 586, 774 i.p. (Babbini) |





![7-Chloro-5-(2-fluorophenyl)-1H-benzo[e][1,4]diazepin-2(3H)-one](https://img.chemicalbook.com/CAS/GIF/2886-65-9.gif)