PRODUCT Properties
| Melting point: | 205-206° |
| Boiling point: | 506.5±50.0 °C(Predicted) |
| Density | 1.3052 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| Flash point: | 11 °C |
| storage temp. | −20°C |
| solubility | Practically insoluble in water, slightly soluble in ethanol (96 per cent). |
| form | liquid |
| pka | pKa 1.6/11.6(5% MeOH in H2O,t =20,I=0.15) (Uncertain) |
| Water Solubility | 20mg/L(22 ºC) |
| Major Application | clinical testing |
| InChI | 1S/C15H11ClN2O2/c16-10-6-7-12-11(8-10)13(9-4-2-1-3-5-9)18-15(20)14(19)17-12/h1-8,15,20H,(H,17,19) |
| InChIKey | ADIMAYPTOBDMTL-UHFFFAOYSA-N |
| SMILES | OC1N=C(c2ccccc2)c3cc(Cl)ccc3NC1=O |
| CAS DataBase Reference | 604-75-1(CAS DataBase Reference) |
| IARC | 2B (Vol. Sup 7, 66) 1996 |
| EPA Substance Registry System | Oxazepam (604-75-1) |
Description and Uses
Anxiolytic; muscle relaxant (skeletal); anticonvulsant; ligand for the GABAA receptor benzodiazepine modulatory site. Controlled substance (depressant).
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H336-H351 |
| Precautionary statements | P202-P261-P271-P280-P304+P340+P312-P308+P313 |
| target organs | Eyes,Central nervous system |
| Hazard Codes | Xn,T,F |
| Risk Statements | 40-39/23/24/25-23/24/25-11 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN 1230 3/PG 2 |
| WGK Germany | 3 |
| RTECS | DF1400000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2933910000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
| Hazardous Substances Data | 604-75-1(Hazardous Substances Data) |
| Toxicity | LD50 in mice, rats (mg/kg): >5010, >5010 orally (Goldenthal) |
