LN7228238
2848-96-6
Synonym(s):
(±)-Lorazepam;3-(Acetyloxy)-7-chloro-5-(2-chlorophenyl)-1,3-dihydro-2H-1,4-benzodiazepin-2-one
CAS NO.：2848-96-6
Empirical Formula: C17H12Cl2N2O3
Molecular Weight: 363.19
MDL number: MFCD00869660
EINECS: 220-653-7
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB9344.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 243-245 °C |
| Boiling point: | 524.4±50.0 °C(Predicted) |
| Density | 1.45±0.1 g/cm3(Predicted) |
| pka | 10.34±0.70(Predicted) |
| BRN | 764089 |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C17H12Cl2N2O3/c1-9(22)24-17-16(23)20-14-7-6-10(18)8-12(14)15(21-17)11-4-2-3-5-13(11)19/h2-8,17H,1H3,(H,20,23) |
| InChIKey | CYDZMDOLVUBPNL-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1N=C(c2ccccc2Cl)c3cc(Cl)ccc3NC1=O |
| LogP | 3.24 |
Description and Uses
Lorazepam Acetate has been commonly used in the study of its stereoselective binding to human serum albumin (HSA).
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H410 |
| Precautionary statements | P264-P270-P273-P301+P312-P391-P501 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 2 |
| HS Code | 2933997500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
