LN-167528
Lactofen , 0.95&0.99 , 77501-63-4
Synonym(s):
2-Ethoxy-1-methyl-2-oxoethyl 5-(2-chloro-4-trifluoromethylphenoxy)-2-nitrobenzoate;Ethyl O-[5-(2-chloro-α,α,α-trifluoro-p-tolyloxy)-2-nitrobenzoyl]-DL -lactate
CAS NO.：77501-63-4
Empirical Formula: C19H15ClF3NO7
Molecular Weight: 461.77
MDL number: MFCD01632761
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | approximate 48℃(dec.) |
| Boiling point: | 494.0±45.0 °C(Predicted) |
| Density | 1.4660 (estimate) |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| Water Solubility | 110μg/L at 20℃ |
| Major Application | agriculture environmental |
| InChI | 1S/C19H15ClF3NO7/c1-3-29-17(25)10(2)30-18(26)13-9-12(5-6-15(13)24(27)28)31-16-7-4-11(8-14(16)20)19(21,22)23/h4-10H,3H2,1-2H3 |
| InChIKey | CONWAEURSVPLRM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)OC(=O)c1cc(Oc2ccc(cc2Cl)C(F)(F)F)ccc1[N+]([O-])=O |
| LogP | 4.6 at 40℃ |
| CAS DataBase Reference | 77501-63-4(CAS DataBase Reference) |
| EPA Substance Registry System | Lactofen (77501-63-4) |
Description and Uses
Lactofen is a complex ester derivative of Acifluoren, a diphenyl ether herbicide. Lactofen can be used in postemergence applications and is commonly used as foliar spray. Lactofen is used in agriculture to control broadleaved weeds in soybean, cereals, potatoes and peanuts.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H312-H411 |
| Precautionary statements | P273-P280-P302+P352+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 21-51/53 |
| Safety Statements | 36/37-61 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | DG5643120 |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Aquatic Chronic 2 |
| Hazardous Substances Data | 77501-63-4(Hazardous Substances Data) |
