LN-173221
Tetrabutylammonium cyanoborohydride , 99% , 43064-96-6
Synonym(s):
Tetrabutylammonium cyanotrihydroborate
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 144-146 °C(lit.) |
| storage temp. | water-free area |
| solubility | sol most polar (e.g. alcohols, carboxylic acids), polar aprotic (e.g. HMPA, DMSO, DMF), and nonpolar (e.g. CH2Cl2, benzene, hexane) solvents; sparingly sol H2O, ether. |
| form | nonhydroscopic solid |
| color | white |
| InChI | 1S/C16H36N.CH3BN/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1-3/h5-16H2,1-4H3;2H3/q+1;-1 |
| InChIKey | BOHYACMUNXBTGV-UHFFFAOYSA-N |
| SMILES | [BH3-]C#N.CCCC[N+](CCCC)(CCCC)CCCC |
| CAS DataBase Reference | 43064-96-6 |
Description and Uses
Reactant for:
- Hydroxymethylation reactions
- Radical carbonylation reactions
- Reduction reactions (reductant)
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,F |
| Risk Statements | 36/37/38-15 |
| Safety Statements | 26-36-7/8-37/39 |
| WGK Germany | 3 |
| F | 21 |
| HS Code | 29310099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
