LN-437228
BROMETHALIN , 0.95&0.99 , 63333-35-7
CAS NO.：63333-35-7
Empirical Formula: C14H7Br3F3N3O4
Molecular Weight: 577.93
MDL number: MFCD01733226
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 150.5℃ |
| Boiling point: | 190°C (rough estimate) |
| Density | 2.0944 (estimate) |
| vapor pressure | 1.3 x l0-5 Pa (25 °C) |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Solid |
| Water Solubility | <0.1 mg l-1 |
| pka | -9.73±0.50(Predicted) |
| color | Light Yellow to Yellow |
| InChI | InChI=1S/C14H7Br3F3N3O4/c1-21(13-9(16)2-6(15)3-10(13)17)12-8(14(18,19)20)4-7(22(24)25)5-11(12)23(26)27/h2-5H,1H3 |
| InChIKey | USMZPYXTVKAYST-UHFFFAOYSA-N |
| SMILES | C1(N(C)C2=C(Br)C=C(Br)C=C2Br)=C(C(F)(F)F)C=C([N+]([O-])=O)C=C1[N+]([O-])=O |
| EPA Substance Registry System | Bromethalin (63333-35-7) |
Description and Uses
Rodenticide.
Safety
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H300+H330-H410 |
| Precautionary statements | P260-P264-P273-P284-P301+P310-P310 |
| Hazard Codes | T+,N |
| Risk Statements | 26-28-50/53 |
| Safety Statements | 28-36/37-45-60-61 |
| RIDADR | UN2811 - class 6.1 - PG 1 - EHS - Toxic solids, organic, n.o.s., HI: all |
| HS Code | 29214300 |
| Hazardous Substances Data | 63333-35-7(Hazardous Substances Data) |
| Toxicity | LD50 in mice, rats, cats, dogs (mg/kg): 2, 5, 2, 5 orally (Dreikorn) |
